C10H12BrCl2NO2S2 — CID 80578682
5-bromo-4-chloro-N-[(2-chlorocyclopentyl)methyl]thiophene-2-sulfonamide (PubChem CID 80578682) has the molecular formula C10H12BrCl2NO2S2 and a molecular weight of 393.16 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-[(2-chlorocyclopentyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-[(2-chlorocyclopentyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80578682 |
| Molecular Formula | C10H12BrCl2NO2S2 |
| Molecular Weight | 393.16 g/mol |
| Exact Mass | 390.89 |
| IUPAC Name | 5-bromo-4-chloro-N-[(2-chlorocyclopentyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCC1Cl)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C10H12BrCl2NO2S2/c11-10-8(13)4-9(17-10)18(15,16)14-5-6-2-1-3-7(6)12/h4,6-7,14H,1-3,5H2 |
| InChIKey | FVSCNMTWDXBRGQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|