C11H13BrClNO4S2 — CID 115433142
1-[[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]methyl]cyclopentane-1-carboxylic acid (PubChem CID 115433142) has the molecular formula C11H13BrClNO4S2 and a molecular weight of 402.72 g/mol. Its IUPAC name is 1-[[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 115433142 |
| Molecular Formula | C11H13BrClNO4S2 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 400.92 |
| IUPAC Name | 1-[[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNS(=O)(=O)c2cc(Cl)c(Br)s2)CCCC1 |
| InChI | InChI=1S/C11H13BrClNO4S2/c12-9-7(13)5-8(19-9)20(17,18)14-6-11(10(15)16)3-1-2-4-11/h5,14H,1-4,6H2,(H,15,16) |
| InChIKey | SKNYHDOWEWBSKY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |