C9H12ClN3O5S2 — CID 115323938
5-chloro-N-(morpholin-2-ylmethyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 115323938) has the molecular formula C9H12ClN3O5S2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 5-chloro-N-(morpholin-2-ylmethyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(morpholin-2-ylmethyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115323938 |
| Molecular Formula | C9H12ClN3O5S2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 5-chloro-N-(morpholin-2-ylmethyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCC2CNCCO2)sc1Cl |
| InChI | InChI=1S/C9H12ClN3O5S2/c10-9-7(13(14)15)3-8(19-9)20(16,17)12-5-6-4-11-1-2-18-6/h3,6,11-12H,1-2,4-5H2 |
| InChIKey | GQFPMYPBBHPLFW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|