C17H20O6S — CID 2282376
(4-methoxyphenyl) 2,5-diethoxybenzenesulfonate (PubChem CID 2282376) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate.
| Compound Name | (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate |
|---|---|
| PubChem CID | 2282376 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate |
| SMILES | CCOc1ccc(OCC)c(S(=O)(=O)Oc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C17H20O6S/c1-4-21-15-10-11-16(22-5-2)17(12-15)24(18,19)23-14-8-6-13(20-3)7-9-14/h6-12H,4-5H2,1-3H3 |
| InChIKey | PWENGDWRBYSJFY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|