(4-methoxyphenyl) 2,5-diethoxybenzenesulfonate

C17H20O6S — CID 2282376

IUPAC(4-methoxyphenyl) 2,5-diethoxybenzenesulfonate
SMILESCCOc1ccc(OCC)c(S(=O)(=O)Oc2ccc(OC)cc2)c1
InChIInChI=1S/C17H20O6S/c1-4-21-15-10-11-16(22-5-2)17(12-15)24(18,19)23-14-8-6-13(20-3)7-9-14/h6-12H,4-5H2,1-3H3
InChIKeyPWENGDWRBYSJFY-UHFFFAOYSA-N
MW352.41 g/mol
LogP3.26
Rot. Bonds8

About (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate

(4-methoxyphenyl) 2,5-diethoxybenzenesulfonate (PubChem CID 2282376) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate.

Molecular Properties

Compound Name(4-methoxyphenyl) 2,5-diethoxybenzenesulfonate
PubChem CID2282376
Molecular FormulaC17H20O6S
Molecular Weight352.41 g/mol
Exact Mass352.10
IUPAC Name(4-methoxyphenyl) 2,5-diethoxybenzenesulfonate
SMILESCCOc1ccc(OCC)c(S(=O)(=O)Oc2ccc(OC)cc2)c1
InChIInChI=1S/C17H20O6S/c1-4-21-15-10-11-16(22-5-2)17(12-15)24(18,19)23-14-8-6-13(20-3)7-9-14/h6-12H,4-5H2,1-3H3
InChIKeyPWENGDWRBYSJFY-UHFFFAOYSA-N
XLogP3.26
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.41
LogP ≤ 53.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate?
The IUPAC name of (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate (CID 2282376) is (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate.
What is the SMILES notation for (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate?
The canonical SMILES for (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate is CCOc1ccc(OCC)c(S(=O)(=O)Oc2ccc(OC)cc2)c1.
What is the InChIKey of (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate?
The InChIKey is PWENGDWRBYSJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O6S/c1-4-21-15-10-11-16(22-5-2)17(12-15)24(18,19)23-14-8-6-13(20-3)7-9-14/h6-12H,4-5H2,1-3H3.
What are the key properties of (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate?
(4-methoxyphenyl) 2,5-diethoxybenzenesulfonate has a molecular weight of 352.41 g/mol, XLogP of 3.26, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 2,5-diethoxybenzenesulfonate is sourced from PubChem (CID 2282376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).