C17H19ClO4S — CID 139016042
(4-chloro-3,5-dimethylphenyl) 2-ethoxy-5-methylbenzenesulfonate (PubChem CID 139016042) has the molecular formula C17H19ClO4S and a molecular weight of 354.86 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 2-ethoxy-5-methylbenzenesulfonate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 2-ethoxy-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139016042 |
| Molecular Formula | C17H19ClO4S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 2-ethoxy-5-methylbenzenesulfonate |
| SMILES | CCOc1ccc(C)cc1S(=O)(=O)Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C17H19ClO4S/c1-5-21-15-7-6-11(2)8-16(15)23(19,20)22-14-9-12(3)17(18)13(4)10-14/h6-10H,5H2,1-4H3 |
| InChIKey | XXFVBMOISSKLDB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|