C21H29NO3S — CID 100557539
4-methoxy-2-methyl-N-[3-(4-methylphenyl)propyl]-5-propan-2-ylbenzenesulfonamide (PubChem CID 100557539) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-[3-(4-methylphenyl)propyl]-5-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-methoxy-2-methyl-N-[3-(4-methylphenyl)propyl]-5-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 100557539 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 4-methoxy-2-methyl-N-[3-(4-methylphenyl)propyl]-5-propan-2-ylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCCCc2ccc(C)cc2)cc1C(C)C |
| InChI | InChI=1S/C21H29NO3S/c1-15(2)19-14-21(17(4)13-20(19)25-5)26(23,24)22-12-6-7-18-10-8-16(3)9-11-18/h8-11,13-15,22H,6-7,12H2,1-5H3 |
| InChIKey | IJQIUGNHBYECDQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|