C18H15BrClF3N2O3S — CID 54787042
5-bromo-N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 54787042) has the molecular formula C18H15BrClF3N2O3S and a molecular weight of 511.75 g/mol. Its IUPAC name is 5-bromo-N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 54787042 |
| Molecular Formula | C18H15BrClF3N2O3S |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | 5-bromo-N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H15BrClF3N2O3S/c1-27-6-7-28-15-5-3-11(19)9-12(15)16(26)25-17(29)24-14-8-10(18(21,22)23)2-4-13(14)20/h2-5,8-9H,6-7H2,1H3,(H2,24,25,26,29) |
| InChIKey | GZWINCIKMLZDQK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|