C19H19NO5S3 — CID 155801484
methyl 4-methoxy-3-[2-(5-thiophen-2-ylthiophen-2-yl)ethylsulfamoyl]benzoate (PubChem CID 155801484) has the molecular formula C19H19NO5S3 and a molecular weight of 437.56 g/mol. Its IUPAC name is methyl 4-methoxy-3-[2-(5-thiophen-2-ylthiophen-2-yl)ethylsulfamoyl]benzoate.
| Compound Name | methyl 4-methoxy-3-[2-(5-thiophen-2-ylthiophen-2-yl)ethylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 155801484 |
| Molecular Formula | C19H19NO5S3 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | methyl 4-methoxy-3-[2-(5-thiophen-2-ylthiophen-2-yl)ethylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(OC)c(S(=O)(=O)NCCc2ccc(-c3cccs3)s2)c1 |
| InChI | InChI=1S/C19H19NO5S3/c1-24-15-7-5-13(19(21)25-2)12-18(15)28(22,23)20-10-9-14-6-8-17(27-14)16-4-3-11-26-16/h3-8,11-12,20H,9-10H2,1-2H3 |
| InChIKey | WVOWGNUJCUAUMR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |