C21H15N3O5S2 — CID 155271358
methyl 3-[[5-cyano-2-(5-cyanothiophen-2-yl)phenyl]sulfamoyl]-4-methoxybenzoate (PubChem CID 155271358) has the molecular formula C21H15N3O5S2 and a molecular weight of 453.50 g/mol. Its IUPAC name is methyl 3-[[5-cyano-2-(5-cyanothiophen-2-yl)phenyl]sulfamoyl]-4-methoxybenzoate.
| Compound Name | methyl 3-[[5-cyano-2-(5-cyanothiophen-2-yl)phenyl]sulfamoyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 155271358 |
| Molecular Formula | C21H15N3O5S2 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | methyl 3-[[5-cyano-2-(5-cyanothiophen-2-yl)phenyl]sulfamoyl]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(S(=O)(=O)Nc2cc(C#N)ccc2-c2ccc(C#N)s2)c1 |
| InChI | InChI=1S/C21H15N3O5S2/c1-28-18-7-4-14(21(25)29-2)10-20(18)31(26,27)24-17-9-13(11-22)3-6-16(17)19-8-5-15(12-23)30-19/h3-10,24H,1-2H3 |
| InChIKey | AFLGVDGMCXVRDV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |