C22H19N3O4S — CID 155271393
methyl 3-[(5-cyano-2-pyrrol-1-ylphenyl)sulfamoyl]-4-cyclopropylbenzoate (PubChem CID 155271393) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is methyl 3-[(5-cyano-2-pyrrol-1-ylphenyl)sulfamoyl]-4-cyclopropylbenzoate.
| Compound Name | methyl 3-[(5-cyano-2-pyrrol-1-ylphenyl)sulfamoyl]-4-cyclopropylbenzoate |
|---|---|
| PubChem CID | 155271393 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | methyl 3-[(5-cyano-2-pyrrol-1-ylphenyl)sulfamoyl]-4-cyclopropylbenzoate |
| SMILES | COC(=O)c1ccc(C2CC2)c(S(=O)(=O)Nc2cc(C#N)ccc2-n2cccc2)c1 |
| InChI | InChI=1S/C22H19N3O4S/c1-29-22(26)17-7-8-18(16-5-6-16)21(13-17)30(27,28)24-19-12-15(14-23)4-9-20(19)25-10-2-3-11-25/h2-4,7-13,16,24H,5-6H2,1H3 |
| InChIKey | DDUCSBQUHDGWLV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |