C25H23ClN4O4S — CID 155271601
methyl 3-[[4-chloro-5-(2-methylpyrazol-3-yl)-2-pyrrol-1-ylphenyl]sulfamoyl]-4-cyclopropylbenzoate (PubChem CID 155271601) has the molecular formula C25H23ClN4O4S and a molecular weight of 511.00 g/mol. Its IUPAC name is methyl 3-[[4-chloro-5-(2-methylpyrazol-3-yl)-2-pyrrol-1-ylphenyl]sulfamoyl]-4-cyclopropylbenzoate.
| Compound Name | methyl 3-[[4-chloro-5-(2-methylpyrazol-3-yl)-2-pyrrol-1-ylphenyl]sulfamoyl]-4-cyclopropylbenzoate |
|---|---|
| PubChem CID | 155271601 |
| Molecular Formula | C25H23ClN4O4S |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | methyl 3-[[4-chloro-5-(2-methylpyrazol-3-yl)-2-pyrrol-1-ylphenyl]sulfamoyl]-4-cyclopropylbenzoate |
| SMILES | COC(=O)c1ccc(C2CC2)c(S(=O)(=O)Nc2cc(-c3ccnn3C)c(Cl)cc2-n2cccc2)c1 |
| InChI | InChI=1S/C25H23ClN4O4S/c1-29-22(9-10-27-29)19-14-21(23(15-20(19)26)30-11-3-4-12-30)28-35(32,33)24-13-17(25(31)34-2)7-8-18(24)16-5-6-16/h3-4,7-16,28H,5-6H2,1-2H3 |
| InChIKey | ATKLHPSRQCRLLJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|