C22H15N3O4S2 — CID 155271348
3-[[5-cyano-2-(5-cyanothiophen-2-yl)phenyl]sulfamoyl]-4-cyclopropylbenzoic acid (PubChem CID 155271348) has the molecular formula C22H15N3O4S2 and a molecular weight of 449.51 g/mol. Its IUPAC name is 3-[[5-cyano-2-(5-cyanothiophen-2-yl)phenyl]sulfamoyl]-4-cyclopropylbenzoic acid.
| Compound Name | 3-[[5-cyano-2-(5-cyanothiophen-2-yl)phenyl]sulfamoyl]-4-cyclopropylbenzoic acid |
|---|---|
| PubChem CID | 155271348 |
| Molecular Formula | C22H15N3O4S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 3-[[5-cyano-2-(5-cyanothiophen-2-yl)phenyl]sulfamoyl]-4-cyclopropylbenzoic acid |
| SMILES | N#Cc1ccc(-c2ccc(C#N)s2)c(NS(=O)(=O)c2cc(C(=O)O)ccc2C2CC2)c1 |
| InChI | InChI=1S/C22H15N3O4S2/c23-11-13-1-6-18(20-8-5-16(12-24)30-20)19(9-13)25-31(28,29)21-10-15(22(26)27)4-7-17(21)14-2-3-14/h1,4-10,14,25H,2-3H2,(H,26,27) |
| InChIKey | PWBFTBPBWSZDNX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 131.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |