C20H18FNO6S3 — CID 155271386
4-ethyl-3-[[2-(5-fluorothiophen-2-yl)-5-methylsulfonylphenyl]sulfamoyl]benzoic acid (PubChem CID 155271386) has the molecular formula C20H18FNO6S3 and a molecular weight of 483.56 g/mol. Its IUPAC name is 4-ethyl-3-[[2-(5-fluorothiophen-2-yl)-5-methylsulfonylphenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-ethyl-3-[[2-(5-fluorothiophen-2-yl)-5-methylsulfonylphenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155271386 |
| Molecular Formula | C20H18FNO6S3 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 4-ethyl-3-[[2-(5-fluorothiophen-2-yl)-5-methylsulfonylphenyl]sulfamoyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cc(S(C)(=O)=O)ccc1-c1ccc(F)s1 |
| InChI | InChI=1S/C20H18FNO6S3/c1-3-12-4-5-13(20(23)24)10-18(12)31(27,28)22-16-11-14(30(2,25)26)6-7-15(16)17-8-9-19(21)29-17/h4-11,22H,3H2,1-2H3,(H,23,24) |
| InChIKey | PUEJGSYXIHSEHN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |