C20H15FN2O2S2 — CID 155279904
3-[5-cyano-2-(5-fluorothiophen-2-yl)anilino]sulfanyl-4-ethylbenzoic acid (PubChem CID 155279904) has the molecular formula C20H15FN2O2S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-[5-cyano-2-(5-fluorothiophen-2-yl)anilino]sulfanyl-4-ethylbenzoic acid.
| Compound Name | 3-[5-cyano-2-(5-fluorothiophen-2-yl)anilino]sulfanyl-4-ethylbenzoic acid |
|---|---|
| PubChem CID | 155279904 |
| Molecular Formula | C20H15FN2O2S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-[5-cyano-2-(5-fluorothiophen-2-yl)anilino]sulfanyl-4-ethylbenzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1SNc1cc(C#N)ccc1-c1ccc(F)s1 |
| InChI | InChI=1S/C20H15FN2O2S2/c1-2-13-4-5-14(20(24)25)10-18(13)27-23-16-9-12(11-22)3-6-15(16)17-7-8-19(21)26-17/h3-10,23H,2H2,1H3,(H,24,25) |
| InChIKey | XKIIWKXQQLHRFK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|