C23H19N3O2S — CID 155280022
3-(5-cyano-2-pyridin-2-ylanilino)sulfanyl-4-cyclobutylbenzoic acid (PubChem CID 155280022) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-(5-cyano-2-pyridin-2-ylanilino)sulfanyl-4-cyclobutylbenzoic acid.
| Compound Name | 3-(5-cyano-2-pyridin-2-ylanilino)sulfanyl-4-cyclobutylbenzoic acid |
|---|---|
| PubChem CID | 155280022 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-(5-cyano-2-pyridin-2-ylanilino)sulfanyl-4-cyclobutylbenzoic acid |
| SMILES | N#Cc1ccc(-c2ccccn2)c(NSc2cc(C(=O)O)ccc2C2CCC2)c1 |
| InChI | InChI=1S/C23H19N3O2S/c24-14-15-7-9-19(20-6-1-2-11-25-20)21(12-15)26-29-22-13-17(23(27)28)8-10-18(22)16-4-3-5-16/h1-2,6-13,16,26H,3-5H2,(H,27,28) |
| InChIKey | VECMTQILOPFFRM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|