C23H17FN2O2S — CID 155279894
3-[5-cyano-2-(3-fluorophenyl)anilino]sulfanyl-4-cyclopropylbenzoic acid (PubChem CID 155279894) has the molecular formula C23H17FN2O2S and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-[5-cyano-2-(3-fluorophenyl)anilino]sulfanyl-4-cyclopropylbenzoic acid.
| Compound Name | 3-[5-cyano-2-(3-fluorophenyl)anilino]sulfanyl-4-cyclopropylbenzoic acid |
|---|---|
| PubChem CID | 155279894 |
| Molecular Formula | C23H17FN2O2S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3-[5-cyano-2-(3-fluorophenyl)anilino]sulfanyl-4-cyclopropylbenzoic acid |
| SMILES | N#Cc1ccc(-c2cccc(F)c2)c(NSc2cc(C(=O)O)ccc2C2CC2)c1 |
| InChI | InChI=1S/C23H17FN2O2S/c24-18-3-1-2-16(11-18)19-8-4-14(13-25)10-21(19)26-29-22-12-17(23(27)28)7-9-20(22)15-5-6-15/h1-4,7-12,15,26H,5-6H2,(H,27,28) |
| InChIKey | UECFHPBEEHYQLP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|