C23H23ClN2O3S — CID 167444990
3-[4-chloro-5-cyano-2-(1-cyclobutylethoxy)anilino]sulfanyl-4-cyclopropylbenzoic acid (PubChem CID 167444990) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is 3-[4-chloro-5-cyano-2-(1-cyclobutylethoxy)anilino]sulfanyl-4-cyclopropylbenzoic acid.
| Compound Name | 3-[4-chloro-5-cyano-2-(1-cyclobutylethoxy)anilino]sulfanyl-4-cyclopropylbenzoic acid |
|---|---|
| PubChem CID | 167444990 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 3-[4-chloro-5-cyano-2-(1-cyclobutylethoxy)anilino]sulfanyl-4-cyclopropylbenzoic acid |
| SMILES | CC(Oc1cc(Cl)c(C#N)cc1NSc1cc(C(=O)O)ccc1C1CC1)C1CCC1 |
| InChI | InChI=1S/C23H23ClN2O3S/c1-13(14-3-2-4-14)29-21-11-19(24)17(12-25)9-20(21)26-30-22-10-16(23(27)28)7-8-18(22)15-5-6-15/h7-11,13-15,26H,2-6H2,1H3,(H,27,28) |
| InChIKey | AYGGSEJKPKHFJH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|