C21H14Cl2N2O2S2 — CID 155280036
3-[4-chloro-2-(5-chlorothiophen-2-yl)-5-cyanoanilino]sulfanyl-4-cyclopropylbenzoic acid (PubChem CID 155280036) has the molecular formula C21H14Cl2N2O2S2 and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-[4-chloro-2-(5-chlorothiophen-2-yl)-5-cyanoanilino]sulfanyl-4-cyclopropylbenzoic acid.
| Compound Name | 3-[4-chloro-2-(5-chlorothiophen-2-yl)-5-cyanoanilino]sulfanyl-4-cyclopropylbenzoic acid |
|---|---|
| PubChem CID | 155280036 |
| Molecular Formula | C21H14Cl2N2O2S2 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | 3-[4-chloro-2-(5-chlorothiophen-2-yl)-5-cyanoanilino]sulfanyl-4-cyclopropylbenzoic acid |
| SMILES | N#Cc1cc(NSc2cc(C(=O)O)ccc2C2CC2)c(-c2ccc(Cl)s2)cc1Cl |
| InChI | InChI=1S/C21H14Cl2N2O2S2/c22-16-9-15(18-5-6-20(23)28-18)17(7-13(16)10-24)25-29-19-8-12(21(26)27)3-4-14(19)11-1-2-11/h3-9,11,25H,1-2H2,(H,26,27) |
| InChIKey | GZAZWCZLBBBTLG-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|