C20H19NO6S3 — CID 155271684
4-ethyl-3-[(5-methylsulfonyl-2-thiophen-2-ylphenyl)sulfamoyl]benzoic acid (PubChem CID 155271684) has the molecular formula C20H19NO6S3 and a molecular weight of 465.57 g/mol. Its IUPAC name is 4-ethyl-3-[(5-methylsulfonyl-2-thiophen-2-ylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 4-ethyl-3-[(5-methylsulfonyl-2-thiophen-2-ylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155271684 |
| Molecular Formula | C20H19NO6S3 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 4-ethyl-3-[(5-methylsulfonyl-2-thiophen-2-ylphenyl)sulfamoyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cc(S(C)(=O)=O)ccc1-c1cccs1 |
| InChI | InChI=1S/C20H19NO6S3/c1-3-13-6-7-14(20(22)23)11-19(13)30(26,27)21-17-12-15(29(2,24)25)8-9-16(17)18-5-4-10-28-18/h4-12,21H,3H2,1-2H3,(H,22,23) |
| InChIKey | YNLIAUIWBYYIBP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |