C17H17NO6S — CID 56797701
3-(2,3-dihydro-1,4-benzodioxin-5-ylsulfamoyl)-4-ethylbenzoic acid (PubChem CID 56797701) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-5-ylsulfamoyl)-4-ethylbenzoic acid.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-5-ylsulfamoyl)-4-ethylbenzoic acid |
|---|---|
| PubChem CID | 56797701 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-5-ylsulfamoyl)-4-ethylbenzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cccc2c1OCCO2 |
| InChI | InChI=1S/C17H17NO6S/c1-2-11-6-7-12(17(19)20)10-15(11)25(21,22)18-13-4-3-5-14-16(13)24-9-8-23-14/h3-7,10,18H,2,8-9H2,1H3,(H,19,20) |
| InChIKey | PUBOWUSHJFLOLL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |