C20H22N2O5S — CID 60531945
3-[(2-tert-butyl-1,3-benzoxazol-5-yl)sulfamoyl]-4-ethylbenzoic acid (PubChem CID 60531945) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,3-benzoxazol-5-yl)sulfamoyl]-4-ethylbenzoic acid.
| Compound Name | 3-[(2-tert-butyl-1,3-benzoxazol-5-yl)sulfamoyl]-4-ethylbenzoic acid |
|---|---|
| PubChem CID | 60531945 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-[(2-tert-butyl-1,3-benzoxazol-5-yl)sulfamoyl]-4-ethylbenzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Nc1ccc2oc(C(C)(C)C)nc2c1 |
| InChI | InChI=1S/C20H22N2O5S/c1-5-12-6-7-13(18(23)24)10-17(12)28(25,26)22-14-8-9-16-15(11-14)21-19(27-16)20(2,3)4/h6-11,22H,5H2,1-4H3,(H,23,24) |
| InChIKey | VZTAUZNWRUDJCD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |