C19H19ClN2O5S — CID 39343393
methyl 3-[(2-tert-butyl-1,3-benzoxazol-5-yl)sulfamoyl]-4-chlorobenzoate (PubChem CID 39343393) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is methyl 3-[(2-tert-butyl-1,3-benzoxazol-5-yl)sulfamoyl]-4-chlorobenzoate.
| Compound Name | methyl 3-[(2-tert-butyl-1,3-benzoxazol-5-yl)sulfamoyl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 39343393 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | methyl 3-[(2-tert-butyl-1,3-benzoxazol-5-yl)sulfamoyl]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)Nc2ccc3oc(C(C)(C)C)nc3c2)c1 |
| InChI | InChI=1S/C19H19ClN2O5S/c1-19(2,3)18-21-14-10-12(6-8-15(14)27-18)22-28(24,25)16-9-11(17(23)26-4)5-7-13(16)20/h5-10,22H,1-4H3 |
| InChIKey | LPXZBPDKEFXINA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |