C15H17BrN2O4S2 — CID 26979142
3-[(3-bromophenyl)sulfonylamino]-N,N,4-trimethylbenzenesulfonamide (PubChem CID 26979142) has the molecular formula C15H17BrN2O4S2 and a molecular weight of 433.35 g/mol. Its IUPAC name is 3-[(3-bromophenyl)sulfonylamino]-N,N,4-trimethylbenzenesulfonamide.
| Compound Name | 3-[(3-bromophenyl)sulfonylamino]-N,N,4-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 26979142 |
| Molecular Formula | C15H17BrN2O4S2 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 3-[(3-bromophenyl)sulfonylamino]-N,N,4-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H17BrN2O4S2/c1-11-7-8-14(24(21,22)18(2)3)10-15(11)17-23(19,20)13-6-4-5-12(16)9-13/h4-10,17H,1-3H3 |
| InChIKey | DYEWRFZQZKVCKJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |