C11H18ClN3O2S — CID 64607176
5-chloro-6-(methylamino)-N-(2-methylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 64607176) has the molecular formula C11H18ClN3O2S and a molecular weight of 291.80 g/mol. Its IUPAC name is 5-chloro-6-(methylamino)-N-(2-methylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(methylamino)-N-(2-methylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607176 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-chloro-6-(methylamino)-N-(2-methylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CCC(C)(C)NS(=O)(=O)c1cnc(NC)c(Cl)c1 |
| InChI | InChI=1S/C11H18ClN3O2S/c1-5-11(2,3)15-18(16,17)8-6-9(12)10(13-4)14-7-8/h6-7,15H,5H2,1-4H3,(H,13,14) |
| InChIKey | UIMQXRHVGBULRP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |