C11H15ClN4O3S — CID 64601658
2-[[5-chloro-6-(methylamino)-3-pyridinyl]sulfonylamino]-N-cyclopropylacetamide (PubChem CID 64601658) has the molecular formula C11H15ClN4O3S and a molecular weight of 318.79 g/mol. Its IUPAC name is 2-[[5-chloro-6-(methylamino)-3-pyridinyl]sulfonylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[[5-chloro-6-(methylamino)-3-pyridinyl]sulfonylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 64601658 |
| Molecular Formula | C11H15ClN4O3S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-[[5-chloro-6-(methylamino)-3-pyridinyl]sulfonylamino]-N-cyclopropylacetamide |
| SMILES | CNc1ncc(S(=O)(=O)NCC(=O)NC2CC2)cc1Cl |
| InChI | InChI=1S/C11H15ClN4O3S/c1-13-11-9(12)4-8(5-14-11)20(18,19)15-6-10(17)16-7-2-3-7/h4-5,7,15H,2-3,6H2,1H3,(H,13,14)(H,16,17) |
| InChIKey | FRBGUGGSGGNHSX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |