C11H16N4O3S — CID 62146294
N-cyclopropyl-2-[[2-(methylamino)-3-pyridinyl]sulfonylamino]acetamide (PubChem CID 62146294) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-cyclopropyl-2-[[2-(methylamino)-3-pyridinyl]sulfonylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[[2-(methylamino)-3-pyridinyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 62146294 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-cyclopropyl-2-[[2-(methylamino)-3-pyridinyl]sulfonylamino]acetamide |
| SMILES | CNc1ncccc1S(=O)(=O)NCC(=O)NC1CC1 |
| InChI | InChI=1S/C11H16N4O3S/c1-12-11-9(3-2-6-13-11)19(17,18)14-7-10(16)15-8-4-5-8/h2-3,6,8,14H,4-5,7H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | PGODUCCMRHKNMI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |