C11H13Cl2N3O2S — CID 61139208
4-amino-2,6-dichloro-N-(2-cyanopropyl)-N-methylbenzenesulfonamide (PubChem CID 61139208) has the molecular formula C11H13Cl2N3O2S and a molecular weight of 322.22 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(2-cyanopropyl)-N-methylbenzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(2-cyanopropyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61139208 |
| Molecular Formula | C11H13Cl2N3O2S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(2-cyanopropyl)-N-methylbenzenesulfonamide |
| SMILES | CC(C#N)CN(C)S(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O2S/c1-7(5-14)6-16(2)19(17,18)11-9(12)3-8(15)4-10(11)13/h3-4,7H,6,15H2,1-2H3 |
| InChIKey | JXNFGTDYWQBROP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|