C11H15Cl2N3O3S — CID 106914013
3-[(4-amino-2,6-dichlorophenyl)sulfonyl-methylamino]-N-methylpropanamide (PubChem CID 106914013) has the molecular formula C11H15Cl2N3O3S and a molecular weight of 340.23 g/mol. Its IUPAC name is 3-[(4-amino-2,6-dichlorophenyl)sulfonyl-methylamino]-N-methylpropanamide.
| Compound Name | 3-[(4-amino-2,6-dichlorophenyl)sulfonyl-methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106914013 |
| Molecular Formula | C11H15Cl2N3O3S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3-[(4-amino-2,6-dichlorophenyl)sulfonyl-methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)S(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C11H15Cl2N3O3S/c1-15-10(17)3-4-16(2)20(18,19)11-8(12)5-7(14)6-9(11)13/h5-6H,3-4,14H2,1-2H3,(H,15,17) |
| InChIKey | NKGSZCAXARFNBP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|