C10H13Br2N3O3S — CID 43374774
2-[(4-amino-2,6-dibromophenyl)sulfonyl-methylamino]-N-methylacetamide (PubChem CID 43374774) has the molecular formula C10H13Br2N3O3S and a molecular weight of 415.11 g/mol. Its IUPAC name is 2-[(4-amino-2,6-dibromophenyl)sulfonyl-methylamino]-N-methylacetamide.
| Compound Name | 2-[(4-amino-2,6-dibromophenyl)sulfonyl-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 43374774 |
| Molecular Formula | C10H13Br2N3O3S |
| Molecular Weight | 415.11 g/mol |
| Exact Mass | 412.90 |
| IUPAC Name | 2-[(4-amino-2,6-dibromophenyl)sulfonyl-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)S(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C10H13Br2N3O3S/c1-14-9(16)5-15(2)19(17,18)10-7(11)3-6(13)4-8(10)12/h3-4H,5,13H2,1-2H3,(H,14,16) |
| InChIKey | SHRYOLGQRXZQAQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.11 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|