C8H13N3O3S2 — CID 61301123
2-[(4-aminothiophen-2-yl)sulfonyl-methylamino]-N-methylacetamide (PubChem CID 61301123) has the molecular formula C8H13N3O3S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[(4-aminothiophen-2-yl)sulfonyl-methylamino]-N-methylacetamide.
| Compound Name | 2-[(4-aminothiophen-2-yl)sulfonyl-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 61301123 |
| Molecular Formula | C8H13N3O3S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-[(4-aminothiophen-2-yl)sulfonyl-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C8H13N3O3S2/c1-10-7(12)4-11(2)16(13,14)8-3-6(9)5-15-8/h3,5H,4,9H2,1-2H3,(H,10,12) |
| InChIKey | MYQZWXCJQPKZNA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |