C11H19N3O3S2 — CID 61299810
2-[(4-aminothiophen-2-yl)sulfonyl-methylamino]-N-tert-butylacetamide (PubChem CID 61299810) has the molecular formula C11H19N3O3S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-[(4-aminothiophen-2-yl)sulfonyl-methylamino]-N-tert-butylacetamide.
| Compound Name | 2-[(4-aminothiophen-2-yl)sulfonyl-methylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 61299810 |
| Molecular Formula | C11H19N3O3S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[(4-aminothiophen-2-yl)sulfonyl-methylamino]-N-tert-butylacetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C11H19N3O3S2/c1-11(2,3)13-9(15)6-14(4)19(16,17)10-5-8(12)7-18-10/h5,7H,6,12H2,1-4H3,(H,13,15) |
| InChIKey | URGRUQZATDDBHQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |