C13H23ClN4O2S — CID 82940765
5-chloro-N-[1-(dimethylamino)propan-2-yl]-6-(propylamino)pyridine-3-sulfonamide (PubChem CID 82940765) has the molecular formula C13H23ClN4O2S and a molecular weight of 334.87 g/mol. Its IUPAC name is 5-chloro-N-[1-(dimethylamino)propan-2-yl]-6-(propylamino)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[1-(dimethylamino)propan-2-yl]-6-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 82940765 |
| Molecular Formula | C13H23ClN4O2S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-chloro-N-[1-(dimethylamino)propan-2-yl]-6-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)NC(C)CN(C)C)cc1Cl |
| InChI | InChI=1S/C13H23ClN4O2S/c1-5-6-15-13-12(14)7-11(8-16-13)21(19,20)17-10(2)9-18(3)4/h7-8,10,17H,5-6,9H2,1-4H3,(H,15,16) |
| InChIKey | WXWMVHKDSJPYHE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |