About 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide
2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide (PubChem CID 102756189) has the molecular formula C12H18Cl2N4O
and a molecular weight of 305.21 g/mol. Its IUPAC name is 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide |
| PubChem CID | 102756189 |
| Molecular Formula | C12H18Cl2N4O |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNc1nc(NCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N4O/c1-3-5-16-10(19)7-17-12-9(14)6-8(13)11(18-12)15-4-2/h6H,3-5,7H2,1-2H3,(H,16,19)(H2,15,17,18) |
| InChIKey | LFWNWLIUBPFFDA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide?
The IUPAC name of 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide (CID 102756189) is 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide.
What is the SMILES notation for 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide?
The canonical SMILES for 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide is CCCNC(=O)CNc1nc(NCC)c(Cl)cc1Cl.
What is the InChIKey of 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide?
The InChIKey is LFWNWLIUBPFFDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18Cl2N4O/c1-3-5-16-10(19)7-17-12-9(14)6-8(13)11(18-12)15-4-2/h6H,3-5,7H2,1-2H3,(H,16,19)(H2,15,17,18).
What are the key properties of 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide?
2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide has a molecular weight of 305.21 g/mol, XLogP of 2.76, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-N-propylacetamide is sourced from PubChem (CID 102756189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).