C11H16F4N2O3S — CID 106295811
5-(hydroxymethyl)-1-propyl-N-(2,2,3,3-tetrafluoropropyl)pyrrole-3-sulfonamide (PubChem CID 106295811) has the molecular formula C11H16F4N2O3S and a molecular weight of 332.32 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1-propyl-N-(2,2,3,3-tetrafluoropropyl)pyrrole-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-1-propyl-N-(2,2,3,3-tetrafluoropropyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106295811 |
| Molecular Formula | C11H16F4N2O3S |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 5-(hydroxymethyl)-1-propyl-N-(2,2,3,3-tetrafluoropropyl)pyrrole-3-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCC(F)(F)C(F)F)cc1CO |
| InChI | InChI=1S/C11H16F4N2O3S/c1-2-3-17-5-9(4-8(17)6-18)21(19,20)16-7-11(14,15)10(12)13/h4-5,10,16,18H,2-3,6-7H2,1H3 |
| InChIKey | LFLBFTQJCLXYLB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|