C13H23F2N3O2S — CID 115409245
N-(2,2-difluoroethyl)-1-propyl-5-(propylaminomethyl)pyrrole-3-sulfonamide (PubChem CID 115409245) has the molecular formula C13H23F2N3O2S and a molecular weight of 323.41 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-propyl-5-(propylaminomethyl)pyrrole-3-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-1-propyl-5-(propylaminomethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 115409245 |
| Molecular Formula | C13H23F2N3O2S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-propyl-5-(propylaminomethyl)pyrrole-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NCC(F)F)cn1CCC |
| InChI | InChI=1S/C13H23F2N3O2S/c1-3-5-16-8-11-7-12(10-18(11)6-4-2)21(19,20)17-9-13(14)15/h7,10,13,16-17H,3-6,8-9H2,1-2H3 |
| InChIKey | FQWYOFGBULYOKI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|