C14H27N3O3S — CID 102701589
1-ethyl-N-(2-methoxypropyl)-5-(propylaminomethyl)pyrrole-3-sulfonamide (PubChem CID 102701589) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-ethyl-N-(2-methoxypropyl)-5-(propylaminomethyl)pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-N-(2-methoxypropyl)-5-(propylaminomethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 102701589 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1-ethyl-N-(2-methoxypropyl)-5-(propylaminomethyl)pyrrole-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NCC(C)OC)cn1CC |
| InChI | InChI=1S/C14H27N3O3S/c1-5-7-15-10-13-8-14(11-17(13)6-2)21(18,19)16-9-12(3)20-4/h8,11-12,15-16H,5-7,9-10H2,1-4H3 |
| InChIKey | ULZHHIWGGVJPNZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|