C15H29N3O2S — CID 106059232
1-ethyl-N-(3-methylbutyl)-5-[(propan-2-ylamino)methyl]pyrrole-3-sulfonamide (PubChem CID 106059232) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is 1-ethyl-N-(3-methylbutyl)-5-[(propan-2-ylamino)methyl]pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-N-(3-methylbutyl)-5-[(propan-2-ylamino)methyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106059232 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 1-ethyl-N-(3-methylbutyl)-5-[(propan-2-ylamino)methyl]pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCC(C)C)cc1CNC(C)C |
| InChI | InChI=1S/C15H29N3O2S/c1-6-18-11-15(9-14(18)10-16-13(4)5)21(19,20)17-8-7-12(2)3/h9,11-13,16-17H,6-8,10H2,1-5H3 |
| InChIKey | BJDSQVQZTBCSCJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |