C14H28N4O2S — CID 106055982
1-ethyl-5-(ethylaminomethyl)-N-[2-[ethyl(methyl)amino]ethyl]pyrrole-3-sulfonamide (PubChem CID 106055982) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-ethyl-5-(ethylaminomethyl)-N-[2-[ethyl(methyl)amino]ethyl]pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-5-(ethylaminomethyl)-N-[2-[ethyl(methyl)amino]ethyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106055982 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-ethyl-5-(ethylaminomethyl)-N-[2-[ethyl(methyl)amino]ethyl]pyrrole-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NCCN(C)CC)cn1CC |
| InChI | InChI=1S/C14H28N4O2S/c1-5-15-11-13-10-14(12-18(13)7-3)21(19,20)16-8-9-17(4)6-2/h10,12,15-16H,5-9,11H2,1-4H3 |
| InChIKey | FPDCMUGZSNTXFC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |