C11H21N3O2S2 — CID 114141007
N-[2-[ethyl(methyl)amino]ethyl]-5-(methylaminomethyl)thiophene-3-sulfonamide (PubChem CID 114141007) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]ethyl]-5-(methylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-[2-[ethyl(methyl)amino]ethyl]-5-(methylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114141007 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]ethyl]-5-(methylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCN(C)CCNS(=O)(=O)c1csc(CNC)c1 |
| InChI | InChI=1S/C11H21N3O2S2/c1-4-14(3)6-5-13-18(15,16)11-7-10(8-12-2)17-9-11/h7,9,12-13H,4-6,8H2,1-3H3 |
| InChIKey | ITZUTEXMJZWSSX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |