C14H27N3O2S2 — CID 106095124
5-(ethylaminomethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]thiophene-3-sulfonamide (PubChem CID 106095124) has the molecular formula C14H27N3O2S2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]thiophene-3-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106095124 |
| Molecular Formula | C14H27N3O2S2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-(ethylaminomethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]thiophene-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NCCCN(C)C(C)C)cs1 |
| InChI | InChI=1S/C14H27N3O2S2/c1-5-15-10-13-9-14(11-20-13)21(18,19)16-7-6-8-17(4)12(2)3/h9,11-12,15-16H,5-8,10H2,1-4H3 |
| InChIKey | GJCXRCNYPPDVPU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|