C12H23N3O2S2 — CID 106055603
5-(methylaminomethyl)-N-[2-[methyl(propan-2-yl)amino]ethyl]thiophene-3-sulfonamide (PubChem CID 106055603) has the molecular formula C12H23N3O2S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-[2-[methyl(propan-2-yl)amino]ethyl]thiophene-3-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-[2-[methyl(propan-2-yl)amino]ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106055603 |
| Molecular Formula | C12H23N3O2S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-(methylaminomethyl)-N-[2-[methyl(propan-2-yl)amino]ethyl]thiophene-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCCN(C)C(C)C)cs1 |
| InChI | InChI=1S/C12H23N3O2S2/c1-10(2)15(4)6-5-14-19(16,17)12-7-11(8-13-3)18-9-12/h7,9-10,13-14H,5-6,8H2,1-4H3 |
| InChIKey | KPMFMSXGPIKPST-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |