C13H24N4O3S — CID 106075901
1-ethyl-5-(ethylaminomethyl)-N-morpholin-4-ylpyrrole-3-sulfonamide (PubChem CID 106075901) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-ethyl-5-(ethylaminomethyl)-N-morpholin-4-ylpyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-5-(ethylaminomethyl)-N-morpholin-4-ylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106075901 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-ethyl-5-(ethylaminomethyl)-N-morpholin-4-ylpyrrole-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NN2CCOCC2)cn1CC |
| InChI | InChI=1S/C13H24N4O3S/c1-3-14-10-12-9-13(11-16(12)4-2)21(18,19)15-17-5-7-20-8-6-17/h9,11,14-15H,3-8,10H2,1-2H3 |
| InChIKey | KMQKSMAWPYZRQR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |