C13H20ClN3O3S — CID 106075759
4-chloro-3-(ethylaminomethyl)-N-morpholin-4-ylbenzenesulfonamide (PubChem CID 106075759) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is 4-chloro-3-(ethylaminomethyl)-N-morpholin-4-ylbenzenesulfonamide.
| Compound Name | 4-chloro-3-(ethylaminomethyl)-N-morpholin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106075759 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-chloro-3-(ethylaminomethyl)-N-morpholin-4-ylbenzenesulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NN2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C13H20ClN3O3S/c1-2-15-10-11-9-12(3-4-13(11)14)21(18,19)16-17-5-7-20-8-6-17/h3-4,9,15-16H,2,5-8,10H2,1H3 |
| InChIKey | SFMFKQVYWHZBIA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |