C14H24ClN3O2S — CID 106017229
4-chloro-N-[2-(dimethylamino)propyl]-3-(ethylaminomethyl)benzenesulfonamide (PubChem CID 106017229) has the molecular formula C14H24ClN3O2S and a molecular weight of 333.89 g/mol. Its IUPAC name is 4-chloro-N-[2-(dimethylamino)propyl]-3-(ethylaminomethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(dimethylamino)propyl]-3-(ethylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106017229 |
| Molecular Formula | C14H24ClN3O2S |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-chloro-N-[2-(dimethylamino)propyl]-3-(ethylaminomethyl)benzenesulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NCC(C)N(C)C)ccc1Cl |
| InChI | InChI=1S/C14H24ClN3O2S/c1-5-16-10-12-8-13(6-7-14(12)15)21(19,20)17-9-11(2)18(3)4/h6-8,11,16-17H,5,9-10H2,1-4H3 |
| InChIKey | FNJGXASKXSMAAE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |