C13H21ClN2O2S2 — CID 106077984
3-chloro-4-(ethylaminomethyl)-N-(2-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 106077984) has the molecular formula C13H21ClN2O2S2 and a molecular weight of 336.91 g/mol. Its IUPAC name is 3-chloro-4-(ethylaminomethyl)-N-(2-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-(ethylaminomethyl)-N-(2-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106077984 |
| Molecular Formula | C13H21ClN2O2S2 |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 3-chloro-4-(ethylaminomethyl)-N-(2-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCC(C)SC)cc1Cl |
| InChI | InChI=1S/C13H21ClN2O2S2/c1-4-15-9-11-5-6-12(7-13(11)14)20(17,18)16-8-10(2)19-3/h5-7,10,15-16H,4,8-9H2,1-3H3 |
| InChIKey | GMICWWUYUUWMBJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |