C13H21ClN2O2S — CID 107091310
N-tert-butyl-3-chloro-4-(ethylaminomethyl)benzenesulfonamide (PubChem CID 107091310) has the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-4-(ethylaminomethyl)benzenesulfonamide.
| Compound Name | N-tert-butyl-3-chloro-4-(ethylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107091310 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-tert-butyl-3-chloro-4-(ethylaminomethyl)benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C13H21ClN2O2S/c1-5-15-9-10-6-7-11(8-12(10)14)19(17,18)16-13(2,3)4/h6-8,15-16H,5,9H2,1-4H3 |
| InChIKey | WFJYEARPZKLFLJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |