C14H23ClN2O2S2 — CID 106064780
4-chloro-3-(ethylaminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 106064780) has the molecular formula C14H23ClN2O2S2 and a molecular weight of 350.94 g/mol. Its IUPAC name is 4-chloro-3-(ethylaminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 4-chloro-3-(ethylaminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106064780 |
| Molecular Formula | C14H23ClN2O2S2 |
| Molecular Weight | 350.94 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-chloro-3-(ethylaminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NCC(C)CSC)ccc1Cl |
| InChI | InChI=1S/C14H23ClN2O2S2/c1-4-16-9-12-7-13(5-6-14(12)15)21(18,19)17-8-11(2)10-20-3/h5-7,11,16-17H,4,8-10H2,1-3H3 |
| InChIKey | UFFHYBALPXNPPT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |