C10H15ClN2O2S2 — CID 63964340
6-chloro-N-(2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide (PubChem CID 63964340) has the molecular formula C10H15ClN2O2S2 and a molecular weight of 294.83 g/mol. Its IUPAC name is 6-chloro-N-(2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63964340 |
| Molecular Formula | C10H15ClN2O2S2 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 6-chloro-N-(2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide |
| SMILES | CSCC(C)CNS(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H15ClN2O2S2/c1-8(7-16-2)5-13-17(14,15)9-3-4-10(11)12-6-9/h3-4,6,8,13H,5,7H2,1-2H3 |
| InChIKey | CHXZSHCSBQYQSD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|