C13H18ClFN2O3S — CID 81452348
N-[(2-chloro-3-fluoro-5-morpholin-4-ylsulfonylphenyl)methyl]ethanamine (PubChem CID 81452348) has the molecular formula C13H18ClFN2O3S and a molecular weight of 336.82 g/mol. Its IUPAC name is N-[(2-chloro-3-fluoro-5-morpholin-4-ylsulfonylphenyl)methyl]ethanamine.
| Compound Name | N-[(2-chloro-3-fluoro-5-morpholin-4-ylsulfonylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81452348 |
| Molecular Formula | C13H18ClFN2O3S |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[(2-chloro-3-fluoro-5-morpholin-4-ylsulfonylphenyl)methyl]ethanamine |
| SMILES | CCNCc1cc(S(=O)(=O)N2CCOCC2)cc(F)c1Cl |
| InChI | InChI=1S/C13H18ClFN2O3S/c1-2-16-9-10-7-11(8-12(15)13(10)14)21(18,19)17-3-5-20-6-4-17/h7-8,16H,2-6,9H2,1H3 |
| InChIKey | SGWCQKGVVCLJNU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |