C14H24ClN3O5S2 — CID 119973418
N-[2-(ethylamino)ethyl]-4-morpholin-4-ylsulfonylbenzenesulfonamide;hydrochloride (PubChem CID 119973418) has the molecular formula C14H24ClN3O5S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-4-morpholin-4-ylsulfonylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-4-morpholin-4-ylsulfonylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973418 |
| Molecular Formula | C14H24ClN3O5S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-4-morpholin-4-ylsulfonylbenzenesulfonamide;hydrochloride |
| SMILES | CCNCCNS(=O)(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C14H23N3O5S2.ClH/c1-2-15-7-8-16-23(18,19)13-3-5-14(6-4-13)24(20,21)17-9-11-22-12-10-17;/h3-6,15-16H,2,7-12H2,1H3;1H |
| InChIKey | CBVUBZFLCCMWMM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|